C25H29F3N6O5 — CID 22029805
7-but-2-ynyl-3-methyl-1-(2-phenylmethoxyethyl)-8-piperazin-1-ylpurine-2,6-dione;2,2,2-trifluoroacetic acid (PubChem CID 22029805) has the molecular formula C25H29F3N6O5 and a molecular weight of 550.54 g/mol. Its IUPAC name is 7-but-2-ynyl-3-methyl-1-(2-phenylmethoxyethyl)-8-piperazin-1-ylpurine-2,6-dione;2,2,2-trifluoroacetic acid.
| Compound Name | 7-but-2-ynyl-3-methyl-1-(2-phenylmethoxyethyl)-8-piperazin-1-ylpurine-2,6-dione;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 22029805 |
| Molecular Formula | C25H29F3N6O5 |
| Molecular Weight | 550.54 g/mol |
| Exact Mass | 550.22 |
| IUPAC Name | 7-but-2-ynyl-3-methyl-1-(2-phenylmethoxyethyl)-8-piperazin-1-ylpurine-2,6-dione;2,2,2-trifluoroacetic acid |
| SMILES | CC#CCn1c(N2CCNCC2)nc2c1c(=O)n(CCOCc1ccccc1)c(=O)n2C.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C23H28N6O3.C2HF3O2/c1-3-4-12-28-19-20(25-22(28)27-13-10-24-11-14-27)26(2)23(31)29(21(19)30)15-16-32-17-18-8-6-5-7-9-18;3-2(4,5)1(6)7/h5-9,24H,10-17H2,1-2H3;(H,6,7) |
| InChIKey | HYVMDEVQXUHJCE-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 123.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.54 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|