C26H31F3N6O5 — CID 22029849
7-but-2-ynyl-1-methyl-3-(3-phenylmethoxypropyl)-8-piperazin-1-ylpurine-2,6-dione;2,2,2-trifluoroacetic acid (PubChem CID 22029849) has the molecular formula C26H31F3N6O5 and a molecular weight of 564.57 g/mol. Its IUPAC name is 7-but-2-ynyl-1-methyl-3-(3-phenylmethoxypropyl)-8-piperazin-1-ylpurine-2,6-dione;2,2,2-trifluoroacetic acid.
| Compound Name | 7-but-2-ynyl-1-methyl-3-(3-phenylmethoxypropyl)-8-piperazin-1-ylpurine-2,6-dione;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 22029849 |
| Molecular Formula | C26H31F3N6O5 |
| Molecular Weight | 564.57 g/mol |
| Exact Mass | 564.23 |
| IUPAC Name | 7-but-2-ynyl-1-methyl-3-(3-phenylmethoxypropyl)-8-piperazin-1-ylpurine-2,6-dione;2,2,2-trifluoroacetic acid |
| SMILES | CC#CCn1c(N2CCNCC2)nc2c1c(=O)n(C)c(=O)n2CCCOCc1ccccc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C24H30N6O3.C2HF3O2/c1-3-4-13-29-20-21(26-23(29)28-15-11-25-12-16-28)30(24(32)27(2)22(20)31)14-8-17-33-18-19-9-6-5-7-10-19;3-2(4,5)1(6)7/h5-7,9-10,25H,8,11-18H2,1-2H3;(H,6,7) |
| InChIKey | GFKQQCNCYKMGSY-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 123.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.57 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|