C19H25F3N6O5 — CID 22029930
7-but-2-ynyl-1-(2-methoxyethyl)-3-methyl-8-piperazin-1-ylpurine-2,6-dione;2,2,2-trifluoroacetic acid (PubChem CID 22029930) has the molecular formula C19H25F3N6O5 and a molecular weight of 474.44 g/mol. Its IUPAC name is 7-but-2-ynyl-1-(2-methoxyethyl)-3-methyl-8-piperazin-1-ylpurine-2,6-dione;2,2,2-trifluoroacetic acid.
| Compound Name | 7-but-2-ynyl-1-(2-methoxyethyl)-3-methyl-8-piperazin-1-ylpurine-2,6-dione;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 22029930 |
| Molecular Formula | C19H25F3N6O5 |
| Molecular Weight | 474.44 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | 7-but-2-ynyl-1-(2-methoxyethyl)-3-methyl-8-piperazin-1-ylpurine-2,6-dione;2,2,2-trifluoroacetic acid |
| SMILES | CC#CCn1c(N2CCNCC2)nc2c1c(=O)n(CCOC)c(=O)n2C.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H24N6O3.C2HF3O2/c1-4-5-8-22-13-14(19-16(22)21-9-6-18-7-10-21)20(2)17(25)23(15(13)24)11-12-26-3;3-2(4,5)1(6)7/h18H,6-12H2,1-3H3;(H,6,7) |
| InChIKey | JLZCEUHSONXBHC-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 123.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.44 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|