C27H35F3N6O5 — CID 22029972
3-methyl-7-(3-methylbut-2-enyl)-1-(3-phenylmethoxypropyl)-8-piperazin-1-ylpurine-2,6-dione;2,2,2-trifluoroacetic acid (PubChem CID 22029972) has the molecular formula C27H35F3N6O5 and a molecular weight of 580.61 g/mol. Its IUPAC name is 3-methyl-7-(3-methylbut-2-enyl)-1-(3-phenylmethoxypropyl)-8-piperazin-1-ylpurine-2,6-dione;2,2,2-trifluoroacetic acid.
| Compound Name | 3-methyl-7-(3-methylbut-2-enyl)-1-(3-phenylmethoxypropyl)-8-piperazin-1-ylpurine-2,6-dione;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 22029972 |
| Molecular Formula | C27H35F3N6O5 |
| Molecular Weight | 580.61 g/mol |
| Exact Mass | 580.26 |
| IUPAC Name | 3-methyl-7-(3-methylbut-2-enyl)-1-(3-phenylmethoxypropyl)-8-piperazin-1-ylpurine-2,6-dione;2,2,2-trifluoroacetic acid |
| SMILES | CC(C)=CCn1c(N2CCNCC2)nc2c1c(=O)n(CCCOCc1ccccc1)c(=O)n2C.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C25H34N6O3.C2HF3O2/c1-19(2)10-14-30-21-22(27-24(30)29-15-11-26-12-16-29)28(3)25(33)31(23(21)32)13-7-17-34-18-20-8-5-4-6-9-20;3-2(4,5)1(6)7/h4-6,8-10,26H,7,11-18H2,1-3H3;(H,6,7) |
| InChIKey | XSQBINLMUKKBFR-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 123.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.61 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|