C22H13ClF6N4 — CID 22030020
2-(chloromethyl)-N-(2,3,5-trifluoro-4-methylphenyl)-7-[3-(trifluoromethyl)-2-pyridinyl]quinazolin-4-amine (PubChem CID 22030020) has the molecular formula C22H13ClF6N4 and a molecular weight of 482.82 g/mol. Its IUPAC name is 2-(chloromethyl)-N-(2,3,5-trifluoro-4-methylphenyl)-7-[3-(trifluoromethyl)-2-pyridinyl]quinazolin-4-amine.
| Compound Name | 2-(chloromethyl)-N-(2,3,5-trifluoro-4-methylphenyl)-7-[3-(trifluoromethyl)-2-pyridinyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 22030020 |
| Molecular Formula | C22H13ClF6N4 |
| Molecular Weight | 482.82 g/mol |
| Exact Mass | 482.07 |
| IUPAC Name | 2-(chloromethyl)-N-(2,3,5-trifluoro-4-methylphenyl)-7-[3-(trifluoromethyl)-2-pyridinyl]quinazolin-4-amine |
| SMILES | Cc1c(F)cc(Nc2nc(CCl)nc3cc(-c4ncccc4C(F)(F)F)ccc23)c(F)c1F |
| InChI | InChI=1S/C22H13ClF6N4/c1-10-14(24)8-16(19(26)18(10)25)32-21-12-5-4-11(7-15(12)31-17(9-23)33-21)20-13(22(27,28)29)3-2-6-30-20/h2-8H,9H2,1H3,(H,31,32,33) |
| InChIKey | AMYKLAQQWHFLBD-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.82 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|