About 4-bromo-3,6-dichloropyridazine
4-bromo-3,6-dichloropyridazine (PubChem CID 22030648) has the molecular formula C4HBrCl2N2
and a molecular weight of 227.88 g/mol. Its IUPAC name is 4-bromo-3,6-dichloropyridazine.
Molecular Properties
| Compound Name | 4-bromo-3,6-dichloropyridazine |
| PubChem CID | 22030648 |
| Molecular Formula | C4HBrCl2N2 |
| Molecular Weight | 227.88 g/mol |
| Exact Mass | 225.87 |
| IUPAC Name | 4-bromo-3,6-dichloropyridazine |
| SMILES | Clc1cc(Br)c(Cl)nn1 |
| InChI | InChI=1S/C4HBrCl2N2/c5-2-1-3(6)8-9-4(2)7/h1H |
| InChIKey | XAXKZIUQIROVNV-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.88 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-bromo-3,6-dichloropyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-3,6-dichloropyridazine?
The IUPAC name of 4-bromo-3,6-dichloropyridazine (CID 22030648) is 4-bromo-3,6-dichloropyridazine.
What is the SMILES notation for 4-bromo-3,6-dichloropyridazine?
The canonical SMILES for 4-bromo-3,6-dichloropyridazine is Clc1cc(Br)c(Cl)nn1.
What is the InChIKey of 4-bromo-3,6-dichloropyridazine?
The InChIKey is XAXKZIUQIROVNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C4HBrCl2N2/c5-2-1-3(6)8-9-4(2)7/h1H.
What are the key properties of 4-bromo-3,6-dichloropyridazine?
4-bromo-3,6-dichloropyridazine has a molecular weight of 227.88 g/mol, XLogP of 2.55, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-3,6-dichloropyridazine is sourced from PubChem (CID 22030648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).