C39H27F2N5O2S2 — CID 22030968
2-[6-[3-(2,6-difluorophenyl)-1-tritylpyrazol-4-yl]imidazo[1,2-a]pyridin-3-yl]-5-methylsulfonyl-1,3-thiazole (PubChem CID 22030968) has the molecular formula C39H27F2N5O2S2 and a molecular weight of 699.81 g/mol. Its IUPAC name is 2-[6-[3-(2,6-difluorophenyl)-1-tritylpyrazol-4-yl]imidazo[1,2-a]pyridin-3-yl]-5-methylsulfonyl-1,3-thiazole.
| Compound Name | 2-[6-[3-(2,6-difluorophenyl)-1-tritylpyrazol-4-yl]imidazo[1,2-a]pyridin-3-yl]-5-methylsulfonyl-1,3-thiazole |
|---|---|
| PubChem CID | 22030968 |
| Molecular Formula | C39H27F2N5O2S2 |
| Molecular Weight | 699.81 g/mol |
| Exact Mass | 699.16 |
| IUPAC Name | 2-[6-[3-(2,6-difluorophenyl)-1-tritylpyrazol-4-yl]imidazo[1,2-a]pyridin-3-yl]-5-methylsulfonyl-1,3-thiazole |
| SMILES | CS(=O)(=O)c1cnc(-c2cnc3ccc(-c4cn(C(c5ccccc5)(c5ccccc5)c5ccccc5)nc4-c4c(F)cccc4F)cn23)s1 |
| InChI | InChI=1S/C39H27F2N5O2S2/c1-50(47,48)35-23-43-38(49-35)33-22-42-34-21-20-26(24-45(33)34)30-25-46(44-37(30)36-31(40)18-11-19-32(36)41)39(27-12-5-2-6-13-27,28-14-7-3-8-15-28)29-16-9-4-10-17-29/h2-25H,1H3 |
| InChIKey | MLSZCSFIDUVYBT-UHFFFAOYSA-N |
| XLogP | 8.51 |
| TPSA | 82.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.81 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|