C40H27F5N6O — CID 22031015
3-[6-[3-(2,6-difluorophenyl)-1-tritylpyrazol-4-yl]imidazo[1,2-a]pyridin-3-yl]-5-(3,3,3-trifluoropropyl)-1,2,4-oxadiazole (PubChem CID 22031015) has the molecular formula C40H27F5N6O and a molecular weight of 702.69 g/mol. Its IUPAC name is 3-[6-[3-(2,6-difluorophenyl)-1-tritylpyrazol-4-yl]imidazo[1,2-a]pyridin-3-yl]-5-(3,3,3-trifluoropropyl)-1,2,4-oxadiazole.
| Compound Name | 3-[6-[3-(2,6-difluorophenyl)-1-tritylpyrazol-4-yl]imidazo[1,2-a]pyridin-3-yl]-5-(3,3,3-trifluoropropyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 22031015 |
| Molecular Formula | C40H27F5N6O |
| Molecular Weight | 702.69 g/mol |
| Exact Mass | 702.22 |
| IUPAC Name | 3-[6-[3-(2,6-difluorophenyl)-1-tritylpyrazol-4-yl]imidazo[1,2-a]pyridin-3-yl]-5-(3,3,3-trifluoropropyl)-1,2,4-oxadiazole |
| SMILES | Fc1cccc(F)c1-c1nn(C(c2ccccc2)(c2ccccc2)c2ccccc2)cc1-c1ccc2ncc(-c3noc(CCC(F)(F)F)n3)n2c1 |
| InChI | InChI=1S/C40H27F5N6O/c41-31-17-10-18-32(42)36(31)37-30(26-19-20-34-46-23-33(50(34)24-26)38-47-35(52-49-38)21-22-39(43,44)45)25-51(48-37)40(27-11-4-1-5-12-27,28-13-6-2-7-14-28)29-15-8-3-9-16-29/h1-20,23-25H,21-22H2 |
| InChIKey | XYRKDOCZZCNGFM-UHFFFAOYSA-N |
| XLogP | 9.53 |
| TPSA | 74.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.69 |
| LogP ≤ 5 | 9.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|