C22H21FN6O2S — CID 22031093
4-[4-(2-fluoro-5-methylsulfonylphenyl)piperazin-1-yl]-6-(1H-pyrazol-4-yl)quinazoline (PubChem CID 22031093) has the molecular formula C22H21FN6O2S and a molecular weight of 452.52 g/mol. Its IUPAC name is 4-[4-(2-fluoro-5-methylsulfonylphenyl)piperazin-1-yl]-6-(1H-pyrazol-4-yl)quinazoline.
| Compound Name | 4-[4-(2-fluoro-5-methylsulfonylphenyl)piperazin-1-yl]-6-(1H-pyrazol-4-yl)quinazoline |
|---|---|
| PubChem CID | 22031093 |
| Molecular Formula | C22H21FN6O2S |
| Molecular Weight | 452.52 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | 4-[4-(2-fluoro-5-methylsulfonylphenyl)piperazin-1-yl]-6-(1H-pyrazol-4-yl)quinazoline |
| SMILES | CS(=O)(=O)c1ccc(F)c(N2CCN(c3ncnc4ccc(-c5cn[nH]c5)cc34)CC2)c1 |
| InChI | InChI=1S/C22H21FN6O2S/c1-32(30,31)17-3-4-19(23)21(11-17)28-6-8-29(9-7-28)22-18-10-15(16-12-26-27-13-16)2-5-20(18)24-14-25-22/h2-5,10-14H,6-9H2,1H3,(H,26,27) |
| InChIKey | REKGKJTVNHVETF-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.52 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |