C37H32F3N5 — CID 22031132
4-(4-methylpiperazin-1-yl)-6-[3-(trifluoromethyl)-1-tritylpyrazol-4-yl]quinoline (PubChem CID 22031132) has the molecular formula C37H32F3N5 and a molecular weight of 603.69 g/mol. Its IUPAC name is 4-(4-methylpiperazin-1-yl)-6-[3-(trifluoromethyl)-1-tritylpyrazol-4-yl]quinoline.
| Compound Name | 4-(4-methylpiperazin-1-yl)-6-[3-(trifluoromethyl)-1-tritylpyrazol-4-yl]quinoline |
|---|---|
| PubChem CID | 22031132 |
| Molecular Formula | C37H32F3N5 |
| Molecular Weight | 603.69 g/mol |
| Exact Mass | 603.26 |
| IUPAC Name | 4-(4-methylpiperazin-1-yl)-6-[3-(trifluoromethyl)-1-tritylpyrazol-4-yl]quinoline |
| SMILES | CN1CCN(c2ccnc3ccc(-c4cn(C(c5ccccc5)(c5ccccc5)c5ccccc5)nc4C(F)(F)F)cc23)CC1 |
| InChI | InChI=1S/C37H32F3N5/c1-43-21-23-44(24-22-43)34-19-20-41-33-18-17-27(25-31(33)34)32-26-45(42-35(32)37(38,39)40)36(28-11-5-2-6-12-28,29-13-7-3-8-14-29)30-15-9-4-10-16-30/h2-20,25-26H,21-24H2,1H3 |
| InChIKey | NQXTXLGGQYVNLV-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.69 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|