C40H28ClFN6O — CID 22031228
3-[6-[3-(4-chloro-2-fluorophenyl)-1-tritylpyrazol-4-yl]imidazo[1,2-a]pyridin-3-yl]-5-cyclopropyl-1,2,4-oxadiazole (PubChem CID 22031228) has the molecular formula C40H28ClFN6O and a molecular weight of 663.16 g/mol. Its IUPAC name is 3-[6-[3-(4-chloro-2-fluorophenyl)-1-tritylpyrazol-4-yl]imidazo[1,2-a]pyridin-3-yl]-5-cyclopropyl-1,2,4-oxadiazole.
| Compound Name | 3-[6-[3-(4-chloro-2-fluorophenyl)-1-tritylpyrazol-4-yl]imidazo[1,2-a]pyridin-3-yl]-5-cyclopropyl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 22031228 |
| Molecular Formula | C40H28ClFN6O |
| Molecular Weight | 663.16 g/mol |
| Exact Mass | 662.20 |
| IUPAC Name | 3-[6-[3-(4-chloro-2-fluorophenyl)-1-tritylpyrazol-4-yl]imidazo[1,2-a]pyridin-3-yl]-5-cyclopropyl-1,2,4-oxadiazole |
| SMILES | Fc1cc(Cl)ccc1-c1nn(C(c2ccccc2)(c2ccccc2)c2ccccc2)cc1-c1ccc2ncc(-c3noc(C4CC4)n3)n2c1 |
| InChI | InChI=1S/C40H28ClFN6O/c41-31-19-20-32(34(42)22-31)37-33(27-18-21-36-43-23-35(47(36)24-27)38-44-39(49-46-38)26-16-17-26)25-48(45-37)40(28-10-4-1-5-11-28,29-12-6-2-7-13-29)30-14-8-3-9-15-30/h1-15,18-26H,16-17H2 |
| InChIKey | YMVSSUAZGJJWQU-UHFFFAOYSA-N |
| XLogP | 9.42 |
| TPSA | 74.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.16 |
| LogP ≤ 5 | 9.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|