C36H35BN2O4 — CID 22031343
methyl 4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-tritylpyrazol-3-yl]benzoate (PubChem CID 22031343) has the molecular formula C36H35BN2O4 and a molecular weight of 570.50 g/mol. Its IUPAC name is methyl 4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-tritylpyrazol-3-yl]benzoate.
| Compound Name | methyl 4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-tritylpyrazol-3-yl]benzoate |
|---|---|
| PubChem CID | 22031343 |
| Molecular Formula | C36H35BN2O4 |
| Molecular Weight | 570.50 g/mol |
| Exact Mass | 570.27 |
| IUPAC Name | methyl 4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-tritylpyrazol-3-yl]benzoate |
| SMILES | COC(=O)c1ccc(-c2nn(C(c3ccccc3)(c3ccccc3)c3ccccc3)cc2B2OC(C)(C)C(C)(C)O2)cc1 |
| InChI | InChI=1S/C36H35BN2O4/c1-34(2)35(3,4)43-37(42-34)31-25-39(38-32(31)26-21-23-27(24-22-26)33(40)41-5)36(28-15-9-6-10-16-28,29-17-11-7-12-18-29)30-19-13-8-14-20-30/h6-25H,1-5H3 |
| InChIKey | KLTKLYYYEIENSS-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.50 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|