About [3-(3,4-difluorophenyl)-1-tritylpyrazol-4-yl]boronic acid
[3-(3,4-difluorophenyl)-1-tritylpyrazol-4-yl]boronic acid (PubChem CID 22031567) has the molecular formula C28H21BF2N2O2
and a molecular weight of 466.30 g/mol. Its IUPAC name is [3-(3,4-difluorophenyl)-1-tritylpyrazol-4-yl]boronic acid.
Molecular Properties
| Compound Name | [3-(3,4-difluorophenyl)-1-tritylpyrazol-4-yl]boronic acid |
| PubChem CID | 22031567 |
| Molecular Formula | C28H21BF2N2O2 |
| Molecular Weight | 466.30 g/mol |
| Exact Mass | 466.17 |
| IUPAC Name | [3-(3,4-difluorophenyl)-1-tritylpyrazol-4-yl]boronic acid |
| SMILES | OB(O)c1cn(C(c2ccccc2)(c2ccccc2)c2ccccc2)nc1-c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C28H21BF2N2O2/c30-25-17-16-20(18-26(25)31)27-24(29(34)35)19-33(32-27)28(21-10-4-1-5-11-21,22-12-6-2-7-13-22)23-14-8-3-9-15-23/h1-19,34-35H |
| InChIKey | SGTWBCGXVCOCQD-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 466.30 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze [3-(3,4-difluorophenyl)-1-tritylpyrazol-4-yl]boronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(3,4-difluorophenyl)-1-tritylpyrazol-4-yl]boronic acid?
The IUPAC name of [3-(3,4-difluorophenyl)-1-tritylpyrazol-4-yl]boronic acid (CID 22031567) is [3-(3,4-difluorophenyl)-1-tritylpyrazol-4-yl]boronic acid.
What is the SMILES notation for [3-(3,4-difluorophenyl)-1-tritylpyrazol-4-yl]boronic acid?
The canonical SMILES for [3-(3,4-difluorophenyl)-1-tritylpyrazol-4-yl]boronic acid is OB(O)c1cn(C(c2ccccc2)(c2ccccc2)c2ccccc2)nc1-c1ccc(F)c(F)c1.
What is the InChIKey of [3-(3,4-difluorophenyl)-1-tritylpyrazol-4-yl]boronic acid?
The InChIKey is SGTWBCGXVCOCQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H21BF2N2O2/c30-25-17-16-20(18-26(25)31)27-24(29(34)35)19-33(32-27)28(21-10-4-1-5-11-21,22-12-6-2-7-13-22)23-14-8-3-9-15-23/h1-19,34-35H.
What are the key properties of [3-(3,4-difluorophenyl)-1-tritylpyrazol-4-yl]boronic acid?
[3-(3,4-difluorophenyl)-1-tritylpyrazol-4-yl]boronic acid has a molecular weight of 466.30 g/mol, XLogP of 4.35, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(3,4-difluorophenyl)-1-tritylpyrazol-4-yl]boronic acid is sourced from PubChem (CID 22031567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).