C18H16ClN3O2S2 — CID 22031572
6-(5-methyl-1H-pyrazol-4-yl)-4-(5-methylsulfonylthiophen-2-yl)quinoline;hydrochloride (PubChem CID 22031572) has the molecular formula C18H16ClN3O2S2 and a molecular weight of 405.93 g/mol. Its IUPAC name is 6-(5-methyl-1H-pyrazol-4-yl)-4-(5-methylsulfonylthiophen-2-yl)quinoline;hydrochloride.
| Compound Name | 6-(5-methyl-1H-pyrazol-4-yl)-4-(5-methylsulfonylthiophen-2-yl)quinoline;hydrochloride |
|---|---|
| PubChem CID | 22031572 |
| Molecular Formula | C18H16ClN3O2S2 |
| Molecular Weight | 405.93 g/mol |
| Exact Mass | 405.04 |
| IUPAC Name | 6-(5-methyl-1H-pyrazol-4-yl)-4-(5-methylsulfonylthiophen-2-yl)quinoline;hydrochloride |
| SMILES | Cc1[nH]ncc1-c1ccc2nccc(-c3ccc(S(C)(=O)=O)s3)c2c1.Cl |
| InChI | InChI=1S/C18H15N3O2S2.ClH/c1-11-15(10-20-21-11)12-3-4-16-14(9-12)13(7-8-19-16)17-5-6-18(24-17)25(2,22)23;/h3-10H,1-2H3,(H,20,21);1H |
| InChIKey | UTEZSZLONJFODC-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.93 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |