C44H30F2N6O — CID 22031657
5-benzyl-3-[6-[3-(2,6-difluorophenyl)-1-tritylpyrazol-4-yl]imidazo[1,2-a]pyridin-3-yl]-1,2,4-oxadiazole (PubChem CID 22031657) has the molecular formula C44H30F2N6O and a molecular weight of 696.76 g/mol. Its IUPAC name is 5-benzyl-3-[6-[3-(2,6-difluorophenyl)-1-tritylpyrazol-4-yl]imidazo[1,2-a]pyridin-3-yl]-1,2,4-oxadiazole.
| Compound Name | 5-benzyl-3-[6-[3-(2,6-difluorophenyl)-1-tritylpyrazol-4-yl]imidazo[1,2-a]pyridin-3-yl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 22031657 |
| Molecular Formula | C44H30F2N6O |
| Molecular Weight | 696.76 g/mol |
| Exact Mass | 696.24 |
| IUPAC Name | 5-benzyl-3-[6-[3-(2,6-difluorophenyl)-1-tritylpyrazol-4-yl]imidazo[1,2-a]pyridin-3-yl]-1,2,4-oxadiazole |
| SMILES | Fc1cccc(F)c1-c1nn(C(c2ccccc2)(c2ccccc2)c2ccccc2)cc1-c1ccc2ncc(-c3noc(Cc4ccccc4)n3)n2c1 |
| InChI | InChI=1S/C44H30F2N6O/c45-36-22-13-23-37(46)41(36)42-35(31-24-25-39-47-27-38(51(39)28-31)43-48-40(53-50-43)26-30-14-5-1-6-15-30)29-52(49-42)44(32-16-7-2-8-17-32,33-18-9-3-10-19-33)34-20-11-4-12-21-34/h1-25,27-29H,26H2 |
| InChIKey | VHHMJHQOKUAUMY-UHFFFAOYSA-N |
| XLogP | 9.62 |
| TPSA | 74.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.76 |
| LogP ≤ 5 | 9.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|