C37H25N9S2 — CID 22031727
2-[6-[3-[5-(2H-tetrazol-5-yl)thiophen-2-yl]-1-tritylpyrazol-4-yl]imidazo[1,2-a]pyridin-3-yl]-1,3-thiazole (PubChem CID 22031727) has the molecular formula C37H25N9S2 and a molecular weight of 659.80 g/mol. Its IUPAC name is 2-[6-[3-[5-(2H-tetrazol-5-yl)thiophen-2-yl]-1-tritylpyrazol-4-yl]imidazo[1,2-a]pyridin-3-yl]-1,3-thiazole.
| Compound Name | 2-[6-[3-[5-(2H-tetrazol-5-yl)thiophen-2-yl]-1-tritylpyrazol-4-yl]imidazo[1,2-a]pyridin-3-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 22031727 |
| Molecular Formula | C37H25N9S2 |
| Molecular Weight | 659.80 g/mol |
| Exact Mass | 659.17 |
| IUPAC Name | 2-[6-[3-[5-(2H-tetrazol-5-yl)thiophen-2-yl]-1-tritylpyrazol-4-yl]imidazo[1,2-a]pyridin-3-yl]-1,3-thiazole |
| SMILES | c1ccc(C(c2ccccc2)(c2ccccc2)n2cc(-c3ccc4ncc(-c5nccs5)n4c3)c(-c3ccc(-c4nn[nH]n4)s3)n2)cc1 |
| InChI | InChI=1S/C37H25N9S2/c1-4-10-26(11-5-1)37(27-12-6-2-7-13-27,28-14-8-3-9-15-28)46-24-29(34(42-46)31-17-18-32(48-31)35-40-43-44-41-35)25-16-19-33-39-22-30(45(33)23-25)36-38-20-21-47-36/h1-24H,(H,40,41,43,44) |
| InChIKey | FBUDYJTVWPPINX-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 102.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.80 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|