About [4-(benzenesulfonyl)-1-tert-butyl-3-methylpyrazol-5-yl] 4-chlorobenzoate
[4-(benzenesulfonyl)-1-tert-butyl-3-methylpyrazol-5-yl] 4-chlorobenzoate (PubChem CID 2203175) has the molecular formula C21H21ClN2O4S
and a molecular weight of 432.93 g/mol. Its IUPAC name is [4-(benzenesulfonyl)-1-tert-butyl-3-methylpyrazol-5-yl] 4-chlorobenzoate.
Molecular Properties
| Compound Name | [4-(benzenesulfonyl)-1-tert-butyl-3-methylpyrazol-5-yl] 4-chlorobenzoate |
| PubChem CID | 2203175 |
| Molecular Formula | C21H21ClN2O4S |
| Molecular Weight | 432.93 g/mol |
| Exact Mass | 432.09 |
| IUPAC Name | [4-(benzenesulfonyl)-1-tert-butyl-3-methylpyrazol-5-yl] 4-chlorobenzoate |
| SMILES | Cc1nn(C(C)(C)C)c(OC(=O)c2ccc(Cl)cc2)c1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C21H21ClN2O4S/c1-14-18(29(26,27)17-8-6-5-7-9-17)19(24(23-14)21(2,3)4)28-20(25)15-10-12-16(22)13-11-15/h5-13H,1-4H3 |
| InChIKey | OUDYQKIXKIEHQF-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 78.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 432.93 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [4-(benzenesulfonyl)-1-tert-butyl-3-methylpyrazol-5-yl] 4-chlorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(benzenesulfonyl)-1-tert-butyl-3-methylpyrazol-5-yl] 4-chlorobenzoate?
The IUPAC name of [4-(benzenesulfonyl)-1-tert-butyl-3-methylpyrazol-5-yl] 4-chlorobenzoate (CID 2203175) is [4-(benzenesulfonyl)-1-tert-butyl-3-methylpyrazol-5-yl] 4-chlorobenzoate.
What is the SMILES notation for [4-(benzenesulfonyl)-1-tert-butyl-3-methylpyrazol-5-yl] 4-chlorobenzoate?
The canonical SMILES for [4-(benzenesulfonyl)-1-tert-butyl-3-methylpyrazol-5-yl] 4-chlorobenzoate is Cc1nn(C(C)(C)C)c(OC(=O)c2ccc(Cl)cc2)c1S(=O)(=O)c1ccccc1.
What is the InChIKey of [4-(benzenesulfonyl)-1-tert-butyl-3-methylpyrazol-5-yl] 4-chlorobenzoate?
The InChIKey is OUDYQKIXKIEHQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21ClN2O4S/c1-14-18(29(26,27)17-8-6-5-7-9-17)19(24(23-14)21(2,3)4)28-20(25)15-10-12-16(22)13-11-15/h5-13H,1-4H3.
What are the key properties of [4-(benzenesulfonyl)-1-tert-butyl-3-methylpyrazol-5-yl] 4-chlorobenzoate?
[4-(benzenesulfonyl)-1-tert-butyl-3-methylpyrazol-5-yl] 4-chlorobenzoate has a molecular weight of 432.93 g/mol, XLogP of 4.65, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(benzenesulfonyl)-1-tert-butyl-3-methylpyrazol-5-yl] 4-chlorobenzoate is sourced from PubChem (CID 2203175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).