C41H32N6OS2 — CID 22031756
pyrrolidin-1-yl-[5-[4-[3-(1,3-thiazol-2-yl)imidazo[1,2-a]pyridin-6-yl]-1-tritylpyrazol-3-yl]thiophen-2-yl]methanone (PubChem CID 22031756) has the molecular formula C41H32N6OS2 and a molecular weight of 688.88 g/mol. Its IUPAC name is pyrrolidin-1-yl-[5-[4-[3-(1,3-thiazol-2-yl)imidazo[1,2-a]pyridin-6-yl]-1-tritylpyrazol-3-yl]thiophen-2-yl]methanone.
| Compound Name | pyrrolidin-1-yl-[5-[4-[3-(1,3-thiazol-2-yl)imidazo[1,2-a]pyridin-6-yl]-1-tritylpyrazol-3-yl]thiophen-2-yl]methanone |
|---|---|
| PubChem CID | 22031756 |
| Molecular Formula | C41H32N6OS2 |
| Molecular Weight | 688.88 g/mol |
| Exact Mass | 688.21 |
| IUPAC Name | pyrrolidin-1-yl-[5-[4-[3-(1,3-thiazol-2-yl)imidazo[1,2-a]pyridin-6-yl]-1-tritylpyrazol-3-yl]thiophen-2-yl]methanone |
| SMILES | O=C(c1ccc(-c2nn(C(c3ccccc3)(c3ccccc3)c3ccccc3)cc2-c2ccc3ncc(-c4nccs4)n3c2)s1)N1CCCC1 |
| InChI | InChI=1S/C41H32N6OS2/c48-40(45-23-10-11-24-45)36-20-19-35(50-36)38-33(29-18-21-37-43-26-34(46(37)27-29)39-42-22-25-49-39)28-47(44-38)41(30-12-4-1-5-13-30,31-14-6-2-7-15-31)32-16-8-3-9-17-32/h1-9,12-22,25-28H,10-11,23-24H2 |
| InChIKey | JZEYNOYXSXLXEI-UHFFFAOYSA-N |
| XLogP | 9.13 |
| TPSA | 68.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.88 |
| LogP ≤ 5 | 9.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|