C43H37N5S2 — CID 22031834
N,N-dimethyl-1-[4-[4-[3-(5-methylsulfanylthiophen-2-yl)imidazo[1,2-a]pyridin-6-yl]-1-tritylpyrazol-3-yl]phenyl]methanamine (PubChem CID 22031834) has the molecular formula C43H37N5S2 and a molecular weight of 687.94 g/mol. Its IUPAC name is N,N-dimethyl-1-[4-[4-[3-(5-methylsulfanylthiophen-2-yl)imidazo[1,2-a]pyridin-6-yl]-1-tritylpyrazol-3-yl]phenyl]methanamine.
| Compound Name | N,N-dimethyl-1-[4-[4-[3-(5-methylsulfanylthiophen-2-yl)imidazo[1,2-a]pyridin-6-yl]-1-tritylpyrazol-3-yl]phenyl]methanamine |
|---|---|
| PubChem CID | 22031834 |
| Molecular Formula | C43H37N5S2 |
| Molecular Weight | 687.94 g/mol |
| Exact Mass | 687.25 |
| IUPAC Name | N,N-dimethyl-1-[4-[4-[3-(5-methylsulfanylthiophen-2-yl)imidazo[1,2-a]pyridin-6-yl]-1-tritylpyrazol-3-yl]phenyl]methanamine |
| SMILES | CSc1ccc(-c2cnc3ccc(-c4cn(C(c5ccccc5)(c5ccccc5)c5ccccc5)nc4-c4ccc(CN(C)C)cc4)cn23)s1 |
| InChI | InChI=1S/C43H37N5S2/c1-46(2)28-31-19-21-32(22-20-31)42-37(33-23-25-40-44-27-38(47(40)29-33)39-24-26-41(49-3)50-39)30-48(45-42)43(34-13-7-4-8-14-34,35-15-9-5-10-16-35)36-17-11-6-12-18-36/h4-27,29-30H,28H2,1-3H3 |
| InChIKey | OMBHVRVIBNFQLZ-UHFFFAOYSA-N |
| XLogP | 10.22 |
| TPSA | 38.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.94 |
| LogP ≤ 5 | 10.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|