C40H29FN6O — CID 22032063
5-cyclopropyl-3-[6-[3-(4-fluorophenyl)-1-tritylpyrazol-4-yl]imidazo[1,2-a]pyridin-3-yl]-1,2,4-oxadiazole (PubChem CID 22032063) has the molecular formula C40H29FN6O and a molecular weight of 628.71 g/mol. Its IUPAC name is 5-cyclopropyl-3-[6-[3-(4-fluorophenyl)-1-tritylpyrazol-4-yl]imidazo[1,2-a]pyridin-3-yl]-1,2,4-oxadiazole.
| Compound Name | 5-cyclopropyl-3-[6-[3-(4-fluorophenyl)-1-tritylpyrazol-4-yl]imidazo[1,2-a]pyridin-3-yl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 22032063 |
| Molecular Formula | C40H29FN6O |
| Molecular Weight | 628.71 g/mol |
| Exact Mass | 628.24 |
| IUPAC Name | 5-cyclopropyl-3-[6-[3-(4-fluorophenyl)-1-tritylpyrazol-4-yl]imidazo[1,2-a]pyridin-3-yl]-1,2,4-oxadiazole |
| SMILES | Fc1ccc(-c2nn(C(c3ccccc3)(c3ccccc3)c3ccccc3)cc2-c2ccc3ncc(-c4noc(C5CC5)n4)n3c2)cc1 |
| InChI | InChI=1S/C40H29FN6O/c41-33-21-18-27(19-22-33)37-34(29-20-23-36-42-24-35(46(36)25-29)38-43-39(48-45-38)28-16-17-28)26-47(44-37)40(30-10-4-1-5-11-30,31-12-6-2-7-13-31)32-14-8-3-9-15-32/h1-15,18-26,28H,16-17H2 |
| InChIKey | USUHNMWNMBOWKK-UHFFFAOYSA-N |
| XLogP | 8.77 |
| TPSA | 74.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.71 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|