C43H29FN6O — CID 22032193
3-[6-[3-(4-fluorophenyl)-1-tritylpyrazol-4-yl]imidazo[1,2-a]pyridin-3-yl]-5-phenyl-1,2,4-oxadiazole (PubChem CID 22032193) has the molecular formula C43H29FN6O and a molecular weight of 664.74 g/mol. Its IUPAC name is 3-[6-[3-(4-fluorophenyl)-1-tritylpyrazol-4-yl]imidazo[1,2-a]pyridin-3-yl]-5-phenyl-1,2,4-oxadiazole.
| Compound Name | 3-[6-[3-(4-fluorophenyl)-1-tritylpyrazol-4-yl]imidazo[1,2-a]pyridin-3-yl]-5-phenyl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 22032193 |
| Molecular Formula | C43H29FN6O |
| Molecular Weight | 664.74 g/mol |
| Exact Mass | 664.24 |
| IUPAC Name | 3-[6-[3-(4-fluorophenyl)-1-tritylpyrazol-4-yl]imidazo[1,2-a]pyridin-3-yl]-5-phenyl-1,2,4-oxadiazole |
| SMILES | Fc1ccc(-c2nn(C(c3ccccc3)(c3ccccc3)c3ccccc3)cc2-c2ccc3ncc(-c4noc(-c5ccccc5)n4)n3c2)cc1 |
| InChI | InChI=1S/C43H29FN6O/c44-36-24-21-30(22-25-36)40-37(32-23-26-39-45-27-38(49(39)28-32)41-46-42(51-48-41)31-13-5-1-6-14-31)29-50(47-40)43(33-15-7-2-8-16-33,34-17-9-3-10-18-34)35-19-11-4-12-20-35/h1-29H |
| InChIKey | HPOLKVCJZDQFTG-UHFFFAOYSA-N |
| XLogP | 9.56 |
| TPSA | 74.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.74 |
| LogP ≤ 5 | 9.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|