C32H43F5O4S — CID 22033013
2-[8-[7-hydroxy-3-(4-hydroxyphenyl)-3-methyl-2,4-dihydrothiochromen-4-yl]octyl]-2-(4,4,5,5,5-pentafluoropentyl)propane-1,3-diol (PubChem CID 22033013) has the molecular formula C32H43F5O4S and a molecular weight of 618.75 g/mol. Its IUPAC name is 2-[8-[7-hydroxy-3-(4-hydroxyphenyl)-3-methyl-2,4-dihydrothiochromen-4-yl]octyl]-2-(4,4,5,5,5-pentafluoropentyl)propane-1,3-diol.
| Compound Name | 2-[8-[7-hydroxy-3-(4-hydroxyphenyl)-3-methyl-2,4-dihydrothiochromen-4-yl]octyl]-2-(4,4,5,5,5-pentafluoropentyl)propane-1,3-diol |
|---|---|
| PubChem CID | 22033013 |
| Molecular Formula | C32H43F5O4S |
| Molecular Weight | 618.75 g/mol |
| Exact Mass | 618.28 |
| IUPAC Name | 2-[8-[7-hydroxy-3-(4-hydroxyphenyl)-3-methyl-2,4-dihydrothiochromen-4-yl]octyl]-2-(4,4,5,5,5-pentafluoropentyl)propane-1,3-diol |
| SMILES | CC1(c2ccc(O)cc2)CSc2cc(O)ccc2C1CCCCCCCCC(CO)(CO)CCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C32H43F5O4S/c1-29(23-10-12-24(40)13-11-23)22-42-28-19-25(41)14-15-26(28)27(29)9-6-4-2-3-5-7-16-30(20-38,21-39)17-8-18-31(33,34)32(35,36)37/h10-15,19,27,38-41H,2-9,16-18,20-22H2,1H3 |
| InChIKey | LKJBNZHOHSNQSA-UHFFFAOYSA-N |
| XLogP | 8.70 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.75 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|