C31H41F5O4 — CID 22033016
4-(4-hydroxyphenyl)-3-methyl-4-(14,14,15,15,15-pentafluoro-10-hydroxypentadecyl)-2,3-dihydrochromen-7-ol (PubChem CID 22033016) has the molecular formula C31H41F5O4 and a molecular weight of 572.66 g/mol. Its IUPAC name is 4-(4-hydroxyphenyl)-3-methyl-4-(14,14,15,15,15-pentafluoro-10-hydroxypentadecyl)-2,3-dihydrochromen-7-ol.
| Compound Name | 4-(4-hydroxyphenyl)-3-methyl-4-(14,14,15,15,15-pentafluoro-10-hydroxypentadecyl)-2,3-dihydrochromen-7-ol |
|---|---|
| PubChem CID | 22033016 |
| Molecular Formula | C31H41F5O4 |
| Molecular Weight | 572.66 g/mol |
| Exact Mass | 572.29 |
| IUPAC Name | 4-(4-hydroxyphenyl)-3-methyl-4-(14,14,15,15,15-pentafluoro-10-hydroxypentadecyl)-2,3-dihydrochromen-7-ol |
| SMILES | CC1COc2cc(O)ccc2C1(CCCCCCCCCC(O)CCCC(F)(F)C(F)(F)F)c1ccc(O)cc1 |
| InChI | InChI=1S/C31H41F5O4/c1-22-21-40-28-20-26(39)16-17-27(28)29(22,23-12-14-25(38)15-13-23)18-8-6-4-2-3-5-7-10-24(37)11-9-19-30(32,33)31(34,35)36/h12-17,20,22,24,37-39H,2-11,18-19,21H2,1H3 |
| InChIKey | BYKJUOYDWRNHEC-UHFFFAOYSA-N |
| XLogP | 8.65 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.66 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|