C36H47F5O6S — CID 22033029
dimethyl 2-[8-[7-methoxy-3-(4-methoxyphenyl)-3-methyl-2,4-dihydrothiochromen-4-yl]octyl]-2-(4,4,5,5,5-pentafluoropentyl)propanedioate (PubChem CID 22033029) has the molecular formula C36H47F5O6S and a molecular weight of 702.82 g/mol. Its IUPAC name is dimethyl 2-[8-[7-methoxy-3-(4-methoxyphenyl)-3-methyl-2,4-dihydrothiochromen-4-yl]octyl]-2-(4,4,5,5,5-pentafluoropentyl)propanedioate.
| Compound Name | dimethyl 2-[8-[7-methoxy-3-(4-methoxyphenyl)-3-methyl-2,4-dihydrothiochromen-4-yl]octyl]-2-(4,4,5,5,5-pentafluoropentyl)propanedioate |
|---|---|
| PubChem CID | 22033029 |
| Molecular Formula | C36H47F5O6S |
| Molecular Weight | 702.82 g/mol |
| Exact Mass | 702.30 |
| IUPAC Name | dimethyl 2-[8-[7-methoxy-3-(4-methoxyphenyl)-3-methyl-2,4-dihydrothiochromen-4-yl]octyl]-2-(4,4,5,5,5-pentafluoropentyl)propanedioate |
| SMILES | COC(=O)C(CCCCCCCCC1c2ccc(OC)cc2SCC1(C)c1ccc(OC)cc1)(CCCC(F)(F)C(F)(F)F)C(=O)OC |
| InChI | InChI=1S/C36H47F5O6S/c1-33(25-14-16-26(44-2)17-15-25)24-48-30-23-27(45-3)18-19-28(30)29(33)13-10-8-6-7-9-11-20-34(31(42)46-4,32(43)47-5)21-12-22-35(37,38)36(39,40)41/h14-19,23,29H,6-13,20-22,24H2,1-5H3 |
| InChIKey | ZKKZWRZHIJIJHX-UHFFFAOYSA-N |
| XLogP | 9.67 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.82 |
| LogP ≤ 5 | 9.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|