C34H43F5O6S — CID 22033031
2-[8-[7-methoxy-3-(4-methoxyphenyl)-3-methyl-2,4-dihydrothiochromen-4-yl]octyl]-2-(4,4,5,5,5-pentafluoropentyl)propanedioic acid (PubChem CID 22033031) has the molecular formula C34H43F5O6S and a molecular weight of 674.77 g/mol. Its IUPAC name is 2-[8-[7-methoxy-3-(4-methoxyphenyl)-3-methyl-2,4-dihydrothiochromen-4-yl]octyl]-2-(4,4,5,5,5-pentafluoropentyl)propanedioic acid.
| Compound Name | 2-[8-[7-methoxy-3-(4-methoxyphenyl)-3-methyl-2,4-dihydrothiochromen-4-yl]octyl]-2-(4,4,5,5,5-pentafluoropentyl)propanedioic acid |
|---|---|
| PubChem CID | 22033031 |
| Molecular Formula | C34H43F5O6S |
| Molecular Weight | 674.77 g/mol |
| Exact Mass | 674.27 |
| IUPAC Name | 2-[8-[7-methoxy-3-(4-methoxyphenyl)-3-methyl-2,4-dihydrothiochromen-4-yl]octyl]-2-(4,4,5,5,5-pentafluoropentyl)propanedioic acid |
| SMILES | COc1ccc(C2(C)CSc3cc(OC)ccc3C2CCCCCCCCC(CCCC(F)(F)C(F)(F)F)(C(=O)O)C(=O)O)cc1 |
| InChI | InChI=1S/C34H43F5O6S/c1-31(23-12-14-24(44-2)15-13-23)22-46-28-21-25(45-3)16-17-26(28)27(31)11-8-6-4-5-7-9-18-32(29(40)41,30(42)43)19-10-20-33(35,36)34(37,38)39/h12-17,21,27H,4-11,18-20,22H2,1-3H3,(H,40,41)(H,42,43) |
| InChIKey | FNIJMVKLTWTMHM-UHFFFAOYSA-N |
| XLogP | 9.50 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.77 |
| LogP ≤ 5 | 9.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|