C31H39F5O4S — CID 22033034
8-[7-methoxy-3-(4-methoxyphenyl)-3-methyl-2,4-dihydrothiochromen-4-yl]-2-(4,4,5,5,5-pentafluoropentyl)octanoic acid (PubChem CID 22033034) has the molecular formula C31H39F5O4S and a molecular weight of 602.71 g/mol. Its IUPAC name is 8-[7-methoxy-3-(4-methoxyphenyl)-3-methyl-2,4-dihydrothiochromen-4-yl]-2-(4,4,5,5,5-pentafluoropentyl)octanoic acid.
| Compound Name | 8-[7-methoxy-3-(4-methoxyphenyl)-3-methyl-2,4-dihydrothiochromen-4-yl]-2-(4,4,5,5,5-pentafluoropentyl)octanoic acid |
|---|---|
| PubChem CID | 22033034 |
| Molecular Formula | C31H39F5O4S |
| Molecular Weight | 602.71 g/mol |
| Exact Mass | 602.25 |
| IUPAC Name | 8-[7-methoxy-3-(4-methoxyphenyl)-3-methyl-2,4-dihydrothiochromen-4-yl]-2-(4,4,5,5,5-pentafluoropentyl)octanoic acid |
| SMILES | COc1ccc(C2(C)CSc3cc(OC)ccc3C2CCCCCCC(CCCC(F)(F)C(F)(F)F)C(=O)O)cc1 |
| InChI | InChI=1S/C31H39F5O4S/c1-29(22-12-14-23(39-2)15-13-22)20-41-27-19-24(40-3)16-17-25(27)26(29)11-7-5-4-6-9-21(28(37)38)10-8-18-30(32,33)31(34,35)36/h12-17,19,21,26H,4-11,18,20H2,1-3H3,(H,37,38) |
| InChIKey | KXDLCUXANLNIPC-UHFFFAOYSA-N |
| XLogP | 9.26 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.71 |
| LogP ≤ 5 | 9.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|