C29H39F3O3S2 — CID 22033036
3-(4-hydroxyphenyl)-3-methyl-4-[9-[2-(2,2,2-trifluoroethoxy)ethylsulfanyl]nonyl]-2,4-dihydrothiochromen-7-ol (PubChem CID 22033036) has the molecular formula C29H39F3O3S2 and a molecular weight of 556.76 g/mol. Its IUPAC name is 3-(4-hydroxyphenyl)-3-methyl-4-[9-[2-(2,2,2-trifluoroethoxy)ethylsulfanyl]nonyl]-2,4-dihydrothiochromen-7-ol.
| Compound Name | 3-(4-hydroxyphenyl)-3-methyl-4-[9-[2-(2,2,2-trifluoroethoxy)ethylsulfanyl]nonyl]-2,4-dihydrothiochromen-7-ol |
|---|---|
| PubChem CID | 22033036 |
| Molecular Formula | C29H39F3O3S2 |
| Molecular Weight | 556.76 g/mol |
| Exact Mass | 556.23 |
| IUPAC Name | 3-(4-hydroxyphenyl)-3-methyl-4-[9-[2-(2,2,2-trifluoroethoxy)ethylsulfanyl]nonyl]-2,4-dihydrothiochromen-7-ol |
| SMILES | CC1(c2ccc(O)cc2)CSc2cc(O)ccc2C1CCCCCCCCCSCCOCC(F)(F)F |
| InChI | InChI=1S/C29H39F3O3S2/c1-28(22-10-12-23(33)13-11-22)21-37-27-19-24(34)14-15-25(27)26(28)9-7-5-3-2-4-6-8-17-36-18-16-35-20-29(30,31)32/h10-15,19,26,33-34H,2-9,16-18,20-21H2,1H3 |
| InChIKey | OXRMCWNLFFDLRN-UHFFFAOYSA-N |
| XLogP | 8.68 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.76 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|