C32H44F5NO3S — CID 22033051
5-[7-methoxy-3-(4-methoxyphenyl)-3-methyl-2,4-dihydrochromen-4-yl]-N-methyl-N-[3-(4,4,5,5,5-pentafluoropentylsulfanyl)propyl]pentan-1-amine (PubChem CID 22033051) has the molecular formula C32H44F5NO3S and a molecular weight of 617.76 g/mol. Its IUPAC name is 5-[7-methoxy-3-(4-methoxyphenyl)-3-methyl-2,4-dihydrochromen-4-yl]-N-methyl-N-[3-(4,4,5,5,5-pentafluoropentylsulfanyl)propyl]pentan-1-amine.
| Compound Name | 5-[7-methoxy-3-(4-methoxyphenyl)-3-methyl-2,4-dihydrochromen-4-yl]-N-methyl-N-[3-(4,4,5,5,5-pentafluoropentylsulfanyl)propyl]pentan-1-amine |
|---|---|
| PubChem CID | 22033051 |
| Molecular Formula | C32H44F5NO3S |
| Molecular Weight | 617.76 g/mol |
| Exact Mass | 617.30 |
| IUPAC Name | 5-[7-methoxy-3-(4-methoxyphenyl)-3-methyl-2,4-dihydrochromen-4-yl]-N-methyl-N-[3-(4,4,5,5,5-pentafluoropentylsulfanyl)propyl]pentan-1-amine |
| SMILES | COc1ccc(C2(C)COc3cc(OC)ccc3C2CCCCCN(C)CCCSCCCC(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C32H44F5NO3S/c1-30(24-11-13-25(39-3)14-12-24)23-41-29-22-26(40-4)15-16-27(29)28(30)10-6-5-7-18-38(2)19-9-21-42-20-8-17-31(33,34)32(35,36)37/h11-16,22,28H,5-10,17-21,23H2,1-4H3 |
| InChIKey | ATWLSCRFDAUFPG-UHFFFAOYSA-N |
| XLogP | 8.73 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.76 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|