C31H41F5O2S2 — CID 22033082
3-methyl-3-(2-methylphenyl)-4-[9-(4,4,5,5,5-pentafluoropentylsulfinyl)nonyl]-2,4-dihydrothiochromen-7-ol (PubChem CID 22033082) has the molecular formula C31H41F5O2S2 and a molecular weight of 604.79 g/mol. Its IUPAC name is 3-methyl-3-(2-methylphenyl)-4-[9-(4,4,5,5,5-pentafluoropentylsulfinyl)nonyl]-2,4-dihydrothiochromen-7-ol.
| Compound Name | 3-methyl-3-(2-methylphenyl)-4-[9-(4,4,5,5,5-pentafluoropentylsulfinyl)nonyl]-2,4-dihydrothiochromen-7-ol |
|---|---|
| PubChem CID | 22033082 |
| Molecular Formula | C31H41F5O2S2 |
| Molecular Weight | 604.79 g/mol |
| Exact Mass | 604.25 |
| IUPAC Name | 3-methyl-3-(2-methylphenyl)-4-[9-(4,4,5,5,5-pentafluoropentylsulfinyl)nonyl]-2,4-dihydrothiochromen-7-ol |
| SMILES | Cc1ccccc1C1(C)CSc2cc(O)ccc2C1CCCCCCCCCS(=O)CCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C31H41F5O2S2/c1-23-13-9-10-14-26(23)29(2)22-39-28-21-24(37)16-17-25(28)27(29)15-8-6-4-3-5-7-11-19-40(38)20-12-18-30(32,33)31(34,35)36/h9-10,13-14,16-17,21,27,37H,3-8,11-12,15,18-20,22H2,1-2H3 |
| InChIKey | AHPNXXORVXOCCJ-UHFFFAOYSA-N |
| XLogP | 9.70 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.79 |
| LogP ≤ 5 | 9.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|