C33H46F5NO7S — CID 22033104
4,4,5,5,5-pentafluoro-N-[8-[7-(methoxymethoxy)-3-[4-(methoxymethoxy)phenyl]-3-methyl-2,4-dihydrochromen-4-yl]octyl]pentane-1-sulfonamide (PubChem CID 22033104) has the molecular formula C33H46F5NO7S and a molecular weight of 695.79 g/mol. Its IUPAC name is 4,4,5,5,5-pentafluoro-N-[8-[7-(methoxymethoxy)-3-[4-(methoxymethoxy)phenyl]-3-methyl-2,4-dihydrochromen-4-yl]octyl]pentane-1-sulfonamide.
| Compound Name | 4,4,5,5,5-pentafluoro-N-[8-[7-(methoxymethoxy)-3-[4-(methoxymethoxy)phenyl]-3-methyl-2,4-dihydrochromen-4-yl]octyl]pentane-1-sulfonamide |
|---|---|
| PubChem CID | 22033104 |
| Molecular Formula | C33H46F5NO7S |
| Molecular Weight | 695.79 g/mol |
| Exact Mass | 695.29 |
| IUPAC Name | 4,4,5,5,5-pentafluoro-N-[8-[7-(methoxymethoxy)-3-[4-(methoxymethoxy)phenyl]-3-methyl-2,4-dihydrochromen-4-yl]octyl]pentane-1-sulfonamide |
| SMILES | COCOc1ccc(C2(C)COc3cc(OCOC)ccc3C2CCCCCCCCNS(=O)(=O)CCCC(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C33H46F5NO7S/c1-31(25-12-14-26(15-13-25)45-23-42-2)22-44-30-21-27(46-24-43-3)16-17-28(30)29(31)11-8-6-4-5-7-9-19-39-47(40,41)20-10-18-32(34,35)33(36,37)38/h12-17,21,29,39H,4-11,18-20,22-24H2,1-3H3 |
| InChIKey | AQXILNDBNPZBKI-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.79 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|