C35H42F5NO4S — CID 22033119
3-(4-hydroxyphenyl)-3-methyl-4-[4-[4-[methyl-[3-(4,4,5,5,5-pentafluoropentylsulfanyl)propyl]amino]butoxy]phenyl]-2,4-dihydrochromen-7-ol (PubChem CID 22033119) has the molecular formula C35H42F5NO4S and a molecular weight of 667.78 g/mol. Its IUPAC name is 3-(4-hydroxyphenyl)-3-methyl-4-[4-[4-[methyl-[3-(4,4,5,5,5-pentafluoropentylsulfanyl)propyl]amino]butoxy]phenyl]-2,4-dihydrochromen-7-ol.
| Compound Name | 3-(4-hydroxyphenyl)-3-methyl-4-[4-[4-[methyl-[3-(4,4,5,5,5-pentafluoropentylsulfanyl)propyl]amino]butoxy]phenyl]-2,4-dihydrochromen-7-ol |
|---|---|
| PubChem CID | 22033119 |
| Molecular Formula | C35H42F5NO4S |
| Molecular Weight | 667.78 g/mol |
| Exact Mass | 667.28 |
| IUPAC Name | 3-(4-hydroxyphenyl)-3-methyl-4-[4-[4-[methyl-[3-(4,4,5,5,5-pentafluoropentylsulfanyl)propyl]amino]butoxy]phenyl]-2,4-dihydrochromen-7-ol |
| SMILES | CN(CCCCOc1ccc(C2c3ccc(O)cc3OCC2(C)c2ccc(O)cc2)cc1)CCCSCCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C35H42F5NO4S/c1-33(26-9-11-27(42)12-10-26)24-45-31-23-28(43)13-16-30(31)32(33)25-7-14-29(15-8-25)44-20-4-3-18-41(2)19-6-22-46-21-5-17-34(36,37)35(38,39)40/h7-16,23,32,42-43H,3-6,17-22,24H2,1-2H3 |
| InChIKey | KHVRGPZGZMQPPJ-UHFFFAOYSA-N |
| XLogP | 8.77 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.78 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|