C30H39F5O4S3 — CID 22033143
3-(4-hydroxyphenyl)-3-methyl-4-[6-[3-(4,4,5,5,5-pentafluoropentylsulfinyl)propylsulfinyl]hexyl]-2,4-dihydrothiochromen-7-ol (PubChem CID 22033143) has the molecular formula C30H39F5O4S3 and a molecular weight of 654.83 g/mol. Its IUPAC name is 3-(4-hydroxyphenyl)-3-methyl-4-[6-[3-(4,4,5,5,5-pentafluoropentylsulfinyl)propylsulfinyl]hexyl]-2,4-dihydrothiochromen-7-ol.
| Compound Name | 3-(4-hydroxyphenyl)-3-methyl-4-[6-[3-(4,4,5,5,5-pentafluoropentylsulfinyl)propylsulfinyl]hexyl]-2,4-dihydrothiochromen-7-ol |
|---|---|
| PubChem CID | 22033143 |
| Molecular Formula | C30H39F5O4S3 |
| Molecular Weight | 654.83 g/mol |
| Exact Mass | 654.19 |
| IUPAC Name | 3-(4-hydroxyphenyl)-3-methyl-4-[6-[3-(4,4,5,5,5-pentafluoropentylsulfinyl)propylsulfinyl]hexyl]-2,4-dihydrothiochromen-7-ol |
| SMILES | CC1(c2ccc(O)cc2)CSc2cc(O)ccc2C1CCCCCCS(=O)CCCS(=O)CCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C30H39F5O4S3/c1-28(22-9-11-23(36)12-10-22)21-40-27-20-24(37)13-14-25(27)26(28)8-4-2-3-5-16-41(38)18-7-19-42(39)17-6-15-29(31,32)30(33,34)35/h9-14,20,26,36-37H,2-8,15-19,21H2,1H3 |
| InChIKey | VTTMGPZGPQCZDA-UHFFFAOYSA-N |
| XLogP | 8.06 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.83 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|