C39H55F5O10S — CID 22033148
ethyl 11-[7-(methoxymethoxy)-3-[4-(methoxymethoxy)phenyl]-3-methyl-2,4-dihydrochromen-4-yl]-3-methylsulfonyloxy-2-(4,4,5,5,5-pentafluoropentyl)undecanoate (PubChem CID 22033148) has the molecular formula C39H55F5O10S and a molecular weight of 810.92 g/mol. Its IUPAC name is ethyl 11-[7-(methoxymethoxy)-3-[4-(methoxymethoxy)phenyl]-3-methyl-2,4-dihydrochromen-4-yl]-3-methylsulfonyloxy-2-(4,4,5,5,5-pentafluoropentyl)undecanoate.
| Compound Name | ethyl 11-[7-(methoxymethoxy)-3-[4-(methoxymethoxy)phenyl]-3-methyl-2,4-dihydrochromen-4-yl]-3-methylsulfonyloxy-2-(4,4,5,5,5-pentafluoropentyl)undecanoate |
|---|---|
| PubChem CID | 22033148 |
| Molecular Formula | C39H55F5O10S |
| Molecular Weight | 810.92 g/mol |
| Exact Mass | 810.34 |
| IUPAC Name | ethyl 11-[7-(methoxymethoxy)-3-[4-(methoxymethoxy)phenyl]-3-methyl-2,4-dihydrochromen-4-yl]-3-methylsulfonyloxy-2-(4,4,5,5,5-pentafluoropentyl)undecanoate |
| SMILES | CCOC(=O)C(CCCC(F)(F)C(F)(F)F)C(CCCCCCCCC1c2ccc(OCOC)cc2OCC1(C)c1ccc(OCOC)cc1)OS(C)(=O)=O |
| InChI | InChI=1S/C39H55F5O10S/c1-6-50-36(45)32(14-13-23-38(40,41)39(42,43)44)34(54-55(5,46)47)16-12-10-8-7-9-11-15-33-31-22-21-30(53-27-49-4)24-35(31)51-25-37(33,2)28-17-19-29(20-18-28)52-26-48-3/h17-22,24,32-34H,6-16,23,25-27H2,1-5H3 |
| InChIKey | ALBQLJYLBHZZAT-UHFFFAOYSA-N |
| XLogP | 9.10 |
| TPSA | 115.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 810.92 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|