C31H39F5O6S — CID 22033172
10-[7-hydroxy-3-(4-hydroxyphenyl)-3-methyl-2,4-dihydrochromen-4-yl]-2-(4,4,5,5,5-pentafluoropentylsulfinyl)decanoic acid (PubChem CID 22033172) has the molecular formula C31H39F5O6S and a molecular weight of 634.70 g/mol. Its IUPAC name is 10-[7-hydroxy-3-(4-hydroxyphenyl)-3-methyl-2,4-dihydrochromen-4-yl]-2-(4,4,5,5,5-pentafluoropentylsulfinyl)decanoic acid.
| Compound Name | 10-[7-hydroxy-3-(4-hydroxyphenyl)-3-methyl-2,4-dihydrochromen-4-yl]-2-(4,4,5,5,5-pentafluoropentylsulfinyl)decanoic acid |
|---|---|
| PubChem CID | 22033172 |
| Molecular Formula | C31H39F5O6S |
| Molecular Weight | 634.70 g/mol |
| Exact Mass | 634.24 |
| IUPAC Name | 10-[7-hydroxy-3-(4-hydroxyphenyl)-3-methyl-2,4-dihydrochromen-4-yl]-2-(4,4,5,5,5-pentafluoropentylsulfinyl)decanoic acid |
| SMILES | CC1(c2ccc(O)cc2)COc2cc(O)ccc2C1CCCCCCCCC(C(=O)O)S(=O)CCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C31H39F5O6S/c1-29(21-11-13-22(37)14-12-21)20-42-26-19-23(38)15-16-24(26)25(29)9-6-4-2-3-5-7-10-27(28(39)40)43(41)18-8-17-30(32,33)31(34,35)36/h11-16,19,25,27,37-38H,2-10,17-18,20H2,1H3,(H,39,40) |
| InChIKey | UYOLMUFIBAYRPT-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.70 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|