C33H37F5O5S — CID 22033183
3-(4-hydroxyphenyl)-3-methyl-4-[1-[4-[3-(4,4,5,5,5-pentafluoropentylsulfinyl)propoxy]phenyl]propyl]-2,4-dihydrochromen-7-ol (PubChem CID 22033183) has the molecular formula C33H37F5O5S and a molecular weight of 640.71 g/mol. Its IUPAC name is 3-(4-hydroxyphenyl)-3-methyl-4-[1-[4-[3-(4,4,5,5,5-pentafluoropentylsulfinyl)propoxy]phenyl]propyl]-2,4-dihydrochromen-7-ol.
| Compound Name | 3-(4-hydroxyphenyl)-3-methyl-4-[1-[4-[3-(4,4,5,5,5-pentafluoropentylsulfinyl)propoxy]phenyl]propyl]-2,4-dihydrochromen-7-ol |
|---|---|
| PubChem CID | 22033183 |
| Molecular Formula | C33H37F5O5S |
| Molecular Weight | 640.71 g/mol |
| Exact Mass | 640.23 |
| IUPAC Name | 3-(4-hydroxyphenyl)-3-methyl-4-[1-[4-[3-(4,4,5,5,5-pentafluoropentylsulfinyl)propoxy]phenyl]propyl]-2,4-dihydrochromen-7-ol |
| SMILES | CCC(c1ccc(OCCCS(=O)CCCC(F)(F)C(F)(F)F)cc1)C1c2ccc(O)cc2OCC1(C)c1ccc(O)cc1 |
| InChI | InChI=1S/C33H37F5O5S/c1-3-27(30-28-15-12-25(40)20-29(28)43-21-31(30,2)23-8-10-24(39)11-9-23)22-6-13-26(14-7-22)42-17-5-19-44(41)18-4-16-32(34,35)33(36,37)38/h6-15,20,27,30,39-40H,3-5,16-19,21H2,1-2H3 |
| InChIKey | YTGGZFYGRYSQGM-UHFFFAOYSA-N |
| XLogP | 8.22 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.71 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|