C36H43F5O6S2 — CID 22033190
7-(methoxymethoxy)-3-[4-(methoxymethoxy)phenyl]-3-methyl-4-[3-[4-[2-(4,4,5,5,5-pentafluoropentylsulfanyl)ethoxy]phenoxy]propyl]-2,4-dihydrothiochromene (PubChem CID 22033190) has the molecular formula C36H43F5O6S2 and a molecular weight of 730.86 g/mol. Its IUPAC name is 7-(methoxymethoxy)-3-[4-(methoxymethoxy)phenyl]-3-methyl-4-[3-[4-[2-(4,4,5,5,5-pentafluoropentylsulfanyl)ethoxy]phenoxy]propyl]-2,4-dihydrothiochromene.
| Compound Name | 7-(methoxymethoxy)-3-[4-(methoxymethoxy)phenyl]-3-methyl-4-[3-[4-[2-(4,4,5,5,5-pentafluoropentylsulfanyl)ethoxy]phenoxy]propyl]-2,4-dihydrothiochromene |
|---|---|
| PubChem CID | 22033190 |
| Molecular Formula | C36H43F5O6S2 |
| Molecular Weight | 730.86 g/mol |
| Exact Mass | 730.24 |
| IUPAC Name | 7-(methoxymethoxy)-3-[4-(methoxymethoxy)phenyl]-3-methyl-4-[3-[4-[2-(4,4,5,5,5-pentafluoropentylsulfanyl)ethoxy]phenoxy]propyl]-2,4-dihydrothiochromene |
| SMILES | COCOc1ccc(C2(C)CSc3cc(OCOC)ccc3C2CCCOc2ccc(OCCSCCCC(F)(F)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C36H43F5O6S2/c1-34(26-7-9-29(10-8-26)46-24-42-2)23-49-33-22-30(47-25-43-3)15-16-31(33)32(34)6-4-18-44-27-11-13-28(14-12-27)45-19-21-48-20-5-17-35(37,38)36(39,40)41/h7-16,22,32H,4-6,17-21,23-25H2,1-3H3 |
| InChIKey | CORDDDMILURHII-UHFFFAOYSA-N |
| XLogP | 9.75 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.86 |
| LogP ≤ 5 | 9.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|