C30H38F6O2S2 — CID 22033199
3-(4-fluorophenyl)-3-methyl-4-[9-(4,4,5,5,5-pentafluoropentylsulfinyl)nonyl]-2,4-dihydrothiochromen-7-ol (PubChem CID 22033199) has the molecular formula C30H38F6O2S2 and a molecular weight of 608.75 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-3-methyl-4-[9-(4,4,5,5,5-pentafluoropentylsulfinyl)nonyl]-2,4-dihydrothiochromen-7-ol.
| Compound Name | 3-(4-fluorophenyl)-3-methyl-4-[9-(4,4,5,5,5-pentafluoropentylsulfinyl)nonyl]-2,4-dihydrothiochromen-7-ol |
|---|---|
| PubChem CID | 22033199 |
| Molecular Formula | C30H38F6O2S2 |
| Molecular Weight | 608.75 g/mol |
| Exact Mass | 608.22 |
| IUPAC Name | 3-(4-fluorophenyl)-3-methyl-4-[9-(4,4,5,5,5-pentafluoropentylsulfinyl)nonyl]-2,4-dihydrothiochromen-7-ol |
| SMILES | CC1(c2ccc(F)cc2)CSc2cc(O)ccc2C1CCCCCCCCCS(=O)CCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C30H38F6O2S2/c1-28(22-11-13-23(31)14-12-22)21-39-27-20-24(37)15-16-25(27)26(28)10-7-5-3-2-4-6-8-18-40(38)19-9-17-29(32,33)30(34,35)36/h11-16,20,26,37H,2-10,17-19,21H2,1H3 |
| InChIKey | SNVZJRDVBCCKOF-UHFFFAOYSA-N |
| XLogP | 9.53 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.75 |
| LogP ≤ 5 | 9.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|