C32H33F5O5S — CID 22033225
6,6,7,7,7-pentafluoro-2-[3-[4-[7-hydroxy-3-(4-hydroxyphenyl)-3-methyl-2,4-dihydrothiochromen-4-yl]phenoxy]propyl]heptanoic acid (PubChem CID 22033225) has the molecular formula C32H33F5O5S and a molecular weight of 624.67 g/mol. Its IUPAC name is 6,6,7,7,7-pentafluoro-2-[3-[4-[7-hydroxy-3-(4-hydroxyphenyl)-3-methyl-2,4-dihydrothiochromen-4-yl]phenoxy]propyl]heptanoic acid.
| Compound Name | 6,6,7,7,7-pentafluoro-2-[3-[4-[7-hydroxy-3-(4-hydroxyphenyl)-3-methyl-2,4-dihydrothiochromen-4-yl]phenoxy]propyl]heptanoic acid |
|---|---|
| PubChem CID | 22033225 |
| Molecular Formula | C32H33F5O5S |
| Molecular Weight | 624.67 g/mol |
| Exact Mass | 624.20 |
| IUPAC Name | 6,6,7,7,7-pentafluoro-2-[3-[4-[7-hydroxy-3-(4-hydroxyphenyl)-3-methyl-2,4-dihydrothiochromen-4-yl]phenoxy]propyl]heptanoic acid |
| SMILES | CC1(c2ccc(O)cc2)CSc2cc(O)ccc2C1c1ccc(OCCCC(CCCC(F)(F)C(F)(F)F)C(=O)O)cc1 |
| InChI | InChI=1S/C32H33F5O5S/c1-30(22-8-10-23(38)11-9-22)19-43-27-18-24(39)12-15-26(27)28(30)20-6-13-25(14-7-20)42-17-3-5-21(29(40)41)4-2-16-31(33,34)32(35,36)37/h6-15,18,21,28,38-39H,2-5,16-17,19H2,1H3,(H,40,41) |
| InChIKey | REAOSUHWAPEOSG-UHFFFAOYSA-N |
| XLogP | 8.52 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.67 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|