C32H42F6OS2 — CID 22033242
3-(4-fluorophenyl)-7-methoxy-3-methyl-4-[10-(4,4,5,5,5-pentafluoropentylsulfanyl)decyl]-2,4-dihydrothiochromene (PubChem CID 22033242) has the molecular formula C32H42F6OS2 and a molecular weight of 620.81 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-7-methoxy-3-methyl-4-[10-(4,4,5,5,5-pentafluoropentylsulfanyl)decyl]-2,4-dihydrothiochromene.
| Compound Name | 3-(4-fluorophenyl)-7-methoxy-3-methyl-4-[10-(4,4,5,5,5-pentafluoropentylsulfanyl)decyl]-2,4-dihydrothiochromene |
|---|---|
| PubChem CID | 22033242 |
| Molecular Formula | C32H42F6OS2 |
| Molecular Weight | 620.81 g/mol |
| Exact Mass | 620.26 |
| IUPAC Name | 3-(4-fluorophenyl)-7-methoxy-3-methyl-4-[10-(4,4,5,5,5-pentafluoropentylsulfanyl)decyl]-2,4-dihydrothiochromene |
| SMILES | COc1ccc2c(c1)SCC(C)(c1ccc(F)cc1)C2CCCCCCCCCCSCCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C32H42F6OS2/c1-30(24-13-15-25(33)16-14-24)23-41-29-22-26(39-2)17-18-27(29)28(30)12-9-7-5-3-4-6-8-10-20-40-21-11-19-31(34,35)32(36,37)38/h13-18,22,28H,3-12,19-21,23H2,1-2H3 |
| InChIKey | BZDXDJRYJDIISQ-UHFFFAOYSA-N |
| XLogP | 11.20 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.81 |
| LogP ≤ 5 | 11.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|