C36H41F5O5S — CID 22033251
9-[4-[7-hydroxy-3-(4-hydroxyphenyl)-3-methyl-2,4-dihydrothiochromen-4-yl]phenoxy]-2-(4,4,5,5,5-pentafluoropentyl)nonanoic acid (PubChem CID 22033251) has the molecular formula C36H41F5O5S and a molecular weight of 680.78 g/mol. Its IUPAC name is 9-[4-[7-hydroxy-3-(4-hydroxyphenyl)-3-methyl-2,4-dihydrothiochromen-4-yl]phenoxy]-2-(4,4,5,5,5-pentafluoropentyl)nonanoic acid.
| Compound Name | 9-[4-[7-hydroxy-3-(4-hydroxyphenyl)-3-methyl-2,4-dihydrothiochromen-4-yl]phenoxy]-2-(4,4,5,5,5-pentafluoropentyl)nonanoic acid |
|---|---|
| PubChem CID | 22033251 |
| Molecular Formula | C36H41F5O5S |
| Molecular Weight | 680.78 g/mol |
| Exact Mass | 680.26 |
| IUPAC Name | 9-[4-[7-hydroxy-3-(4-hydroxyphenyl)-3-methyl-2,4-dihydrothiochromen-4-yl]phenoxy]-2-(4,4,5,5,5-pentafluoropentyl)nonanoic acid |
| SMILES | CC1(c2ccc(O)cc2)CSc2cc(O)ccc2C1c1ccc(OCCCCCCCC(CCCC(F)(F)C(F)(F)F)C(=O)O)cc1 |
| InChI | InChI=1S/C36H41F5O5S/c1-34(26-12-14-27(42)15-13-26)23-47-31-22-28(43)16-19-30(31)32(34)24-10-17-29(18-11-24)46-21-6-4-2-3-5-8-25(33(44)45)9-7-20-35(37,38)36(39,40)41/h10-19,22,25,32,42-43H,2-9,20-21,23H2,1H3,(H,44,45) |
| InChIKey | CFHJOTGPZGDHGO-UHFFFAOYSA-N |
| XLogP | 10.08 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.78 |
| LogP ≤ 5 | 10.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|