C35H39F5O5S — CID 22033264
8-[4-[7-hydroxy-3-(4-hydroxyphenyl)-3-methyl-2,4-dihydrothiochromen-4-yl]phenoxy]-2-(4,4,5,5,5-pentafluoropentyl)octanoic acid (PubChem CID 22033264) has the molecular formula C35H39F5O5S and a molecular weight of 666.75 g/mol. Its IUPAC name is 8-[4-[7-hydroxy-3-(4-hydroxyphenyl)-3-methyl-2,4-dihydrothiochromen-4-yl]phenoxy]-2-(4,4,5,5,5-pentafluoropentyl)octanoic acid.
| Compound Name | 8-[4-[7-hydroxy-3-(4-hydroxyphenyl)-3-methyl-2,4-dihydrothiochromen-4-yl]phenoxy]-2-(4,4,5,5,5-pentafluoropentyl)octanoic acid |
|---|---|
| PubChem CID | 22033264 |
| Molecular Formula | C35H39F5O5S |
| Molecular Weight | 666.75 g/mol |
| Exact Mass | 666.24 |
| IUPAC Name | 8-[4-[7-hydroxy-3-(4-hydroxyphenyl)-3-methyl-2,4-dihydrothiochromen-4-yl]phenoxy]-2-(4,4,5,5,5-pentafluoropentyl)octanoic acid |
| SMILES | CC1(c2ccc(O)cc2)CSc2cc(O)ccc2C1c1ccc(OCCCCCCC(CCCC(F)(F)C(F)(F)F)C(=O)O)cc1 |
| InChI | InChI=1S/C35H39F5O5S/c1-33(25-11-13-26(41)14-12-25)22-46-30-21-27(42)15-18-29(30)31(33)23-9-16-28(17-10-23)45-20-5-3-2-4-7-24(32(43)44)8-6-19-34(36,37)35(38,39)40/h9-18,21,24,31,41-42H,2-8,19-20,22H2,1H3,(H,43,44) |
| InChIKey | HCCGFCTXGMTJSB-UHFFFAOYSA-N |
| XLogP | 9.69 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.75 |
| LogP ≤ 5 | 9.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|