C31H40F6OS2 — CID 22033275
3-(4-fluorophenyl)-7-methoxy-3-methyl-4-[9-(4,4,5,5,5-pentafluoropentylsulfanyl)nonyl]-2,4-dihydrothiochromene (PubChem CID 22033275) has the molecular formula C31H40F6OS2 and a molecular weight of 606.78 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-7-methoxy-3-methyl-4-[9-(4,4,5,5,5-pentafluoropentylsulfanyl)nonyl]-2,4-dihydrothiochromene.
| Compound Name | 3-(4-fluorophenyl)-7-methoxy-3-methyl-4-[9-(4,4,5,5,5-pentafluoropentylsulfanyl)nonyl]-2,4-dihydrothiochromene |
|---|---|
| PubChem CID | 22033275 |
| Molecular Formula | C31H40F6OS2 |
| Molecular Weight | 606.78 g/mol |
| Exact Mass | 606.24 |
| IUPAC Name | 3-(4-fluorophenyl)-7-methoxy-3-methyl-4-[9-(4,4,5,5,5-pentafluoropentylsulfanyl)nonyl]-2,4-dihydrothiochromene |
| SMILES | COc1ccc2c(c1)SCC(C)(c1ccc(F)cc1)C2CCCCCCCCCSCCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C31H40F6OS2/c1-29(23-12-14-24(32)15-13-23)22-40-28-21-25(38-2)16-17-26(28)27(29)11-8-6-4-3-5-7-9-19-39-20-10-18-30(33,34)31(35,36)37/h12-17,21,27H,3-11,18-20,22H2,1-2H3 |
| InChIKey | HYZBDPOWGVBAQT-UHFFFAOYSA-N |
| XLogP | 10.81 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.78 |
| LogP ≤ 5 | 10.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|