C34H37F5O5S — CID 22033368
6,6,7,7,7-pentafluoro-2-[5-[4-[7-hydroxy-3-(4-hydroxyphenyl)-3-methyl-2,4-dihydrothiochromen-4-yl]phenoxy]pentyl]heptanoic acid (PubChem CID 22033368) has the molecular formula C34H37F5O5S and a molecular weight of 652.72 g/mol. Its IUPAC name is 6,6,7,7,7-pentafluoro-2-[5-[4-[7-hydroxy-3-(4-hydroxyphenyl)-3-methyl-2,4-dihydrothiochromen-4-yl]phenoxy]pentyl]heptanoic acid.
| Compound Name | 6,6,7,7,7-pentafluoro-2-[5-[4-[7-hydroxy-3-(4-hydroxyphenyl)-3-methyl-2,4-dihydrothiochromen-4-yl]phenoxy]pentyl]heptanoic acid |
|---|---|
| PubChem CID | 22033368 |
| Molecular Formula | C34H37F5O5S |
| Molecular Weight | 652.72 g/mol |
| Exact Mass | 652.23 |
| IUPAC Name | 6,6,7,7,7-pentafluoro-2-[5-[4-[7-hydroxy-3-(4-hydroxyphenyl)-3-methyl-2,4-dihydrothiochromen-4-yl]phenoxy]pentyl]heptanoic acid |
| SMILES | CC1(c2ccc(O)cc2)CSc2cc(O)ccc2C1c1ccc(OCCCCCC(CCCC(F)(F)C(F)(F)F)C(=O)O)cc1 |
| InChI | InChI=1S/C34H37F5O5S/c1-32(24-10-12-25(40)13-11-24)21-45-29-20-26(41)14-17-28(29)30(32)22-8-15-27(16-9-22)44-19-4-2-3-6-23(31(42)43)7-5-18-33(35,36)34(37,38)39/h8-17,20,23,30,40-41H,2-7,18-19,21H2,1H3,(H,42,43) |
| InChIKey | MJDHIPZFVDDQQP-UHFFFAOYSA-N |
| XLogP | 9.30 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.72 |
| LogP ≤ 5 | 9.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|