C32H43F5O2S2 — CID 22033394
7-methoxy-3-(4-methoxyphenyl)-3-methyl-4-[9-(4,4,5,5,5-pentafluoropentylsulfanyl)nonyl]-2,4-dihydrothiochromene (PubChem CID 22033394) has the molecular formula C32H43F5O2S2 and a molecular weight of 618.82 g/mol. Its IUPAC name is 7-methoxy-3-(4-methoxyphenyl)-3-methyl-4-[9-(4,4,5,5,5-pentafluoropentylsulfanyl)nonyl]-2,4-dihydrothiochromene.
| Compound Name | 7-methoxy-3-(4-methoxyphenyl)-3-methyl-4-[9-(4,4,5,5,5-pentafluoropentylsulfanyl)nonyl]-2,4-dihydrothiochromene |
|---|---|
| PubChem CID | 22033394 |
| Molecular Formula | C32H43F5O2S2 |
| Molecular Weight | 618.82 g/mol |
| Exact Mass | 618.26 |
| IUPAC Name | 7-methoxy-3-(4-methoxyphenyl)-3-methyl-4-[9-(4,4,5,5,5-pentafluoropentylsulfanyl)nonyl]-2,4-dihydrothiochromene |
| SMILES | COc1ccc(C2(C)CSc3cc(OC)ccc3C2CCCCCCCCCSCCCC(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C32H43F5O2S2/c1-30(24-13-15-25(38-2)16-14-24)23-41-29-22-26(39-3)17-18-27(29)28(30)12-9-7-5-4-6-8-10-20-40-21-11-19-31(33,34)32(35,36)37/h13-18,22,28H,4-12,19-21,23H2,1-3H3 |
| InChIKey | OECBLMUFHVVIKV-UHFFFAOYSA-N |
| XLogP | 10.68 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.82 |
| LogP ≤ 5 | 10.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|