C33H37F5O6S — CID 22033432
3-(4-hydroxyphenyl)-3-methyl-4-[3-[4-[3-(4,4,5,5,5-pentafluoropentylsulfonyl)propyl]phenoxy]propyl]-2,4-dihydrochromen-7-ol (PubChem CID 22033432) has the molecular formula C33H37F5O6S and a molecular weight of 656.71 g/mol. Its IUPAC name is 3-(4-hydroxyphenyl)-3-methyl-4-[3-[4-[3-(4,4,5,5,5-pentafluoropentylsulfonyl)propyl]phenoxy]propyl]-2,4-dihydrochromen-7-ol.
| Compound Name | 3-(4-hydroxyphenyl)-3-methyl-4-[3-[4-[3-(4,4,5,5,5-pentafluoropentylsulfonyl)propyl]phenoxy]propyl]-2,4-dihydrochromen-7-ol |
|---|---|
| PubChem CID | 22033432 |
| Molecular Formula | C33H37F5O6S |
| Molecular Weight | 656.71 g/mol |
| Exact Mass | 656.22 |
| IUPAC Name | 3-(4-hydroxyphenyl)-3-methyl-4-[3-[4-[3-(4,4,5,5,5-pentafluoropentylsulfonyl)propyl]phenoxy]propyl]-2,4-dihydrochromen-7-ol |
| SMILES | CC1(c2ccc(O)cc2)COc2cc(O)ccc2C1CCCOc1ccc(CCCS(=O)(=O)CCCC(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C33H37F5O6S/c1-31(24-9-11-25(39)12-10-24)22-44-30-21-26(40)13-16-28(30)29(31)6-2-18-43-27-14-7-23(8-15-27)5-3-19-45(41,42)20-4-17-32(34,35)33(36,37)38/h7-16,21,29,39-40H,2-6,17-20,22H2,1H3 |
| InChIKey | FLVMEHNIYCLFFQ-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.71 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|