C17H15F3N2O3 — CID 22033709
2-(propanoylamino)-5-[2-(trifluoromethyl)anilino]benzoic acid (PubChem CID 22033709) has the molecular formula C17H15F3N2O3 and a molecular weight of 352.31 g/mol. Its IUPAC name is 2-(propanoylamino)-5-[2-(trifluoromethyl)anilino]benzoic acid.
| Compound Name | 2-(propanoylamino)-5-[2-(trifluoromethyl)anilino]benzoic acid |
|---|---|
| PubChem CID | 22033709 |
| Molecular Formula | C17H15F3N2O3 |
| Molecular Weight | 352.31 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | 2-(propanoylamino)-5-[2-(trifluoromethyl)anilino]benzoic acid |
| SMILES | CCC(=O)Nc1ccc(Nc2ccccc2C(F)(F)F)cc1C(=O)O |
| InChI | InChI=1S/C17H15F3N2O3/c1-2-15(23)22-13-8-7-10(9-11(13)16(24)25)21-14-6-4-3-5-12(14)17(18,19)20/h3-9,21H,2H2,1H3,(H,22,23)(H,24,25) |
| InChIKey | ASVJUOVWZFZJQJ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.31 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |