C14H28Cl2N6 — CID 22033797
bis[2-(1,4,5,6-tetrahydropyrimidin-2-yl)propan-2-yl]diazene;dihydrochloride (PubChem CID 22033797) has the molecular formula C14H28Cl2N6 and a molecular weight of 351.33 g/mol. Its IUPAC name is bis[2-(1,4,5,6-tetrahydropyrimidin-2-yl)propan-2-yl]diazene;dihydrochloride.
| Compound Name | bis[2-(1,4,5,6-tetrahydropyrimidin-2-yl)propan-2-yl]diazene;dihydrochloride |
|---|---|
| PubChem CID | 22033797 |
| Molecular Formula | C14H28Cl2N6 |
| Molecular Weight | 351.33 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | bis[2-(1,4,5,6-tetrahydropyrimidin-2-yl)propan-2-yl]diazene;dihydrochloride |
| SMILES | CC(C)(/N=N/C(C)(C)C1=NCCCN1)C1=NCCCN1.Cl.Cl |
| InChI | InChI=1S/C14H26N6.2ClH/c1-13(2,11-15-7-5-8-16-11)19-20-14(3,4)12-17-9-6-10-18-12;;/h5-10H2,1-4H3,(H,15,16)(H,17,18);2*1H/b20-19+;; |
| InChIKey | NBXSIUSZCHNKCZ-LLIZZRELSA-N |
| XLogP | 2.62 |
| TPSA | 73.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.33 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|