About 2-amino-1-(2,3-dihydroindol-1-yl)ethanone
2-amino-1-(2,3-dihydroindol-1-yl)ethanone (PubChem CID 22034314) has the molecular formula C10H12N2O
and a molecular weight of 176.22 g/mol. Its IUPAC name is 2-amino-1-(2,3-dihydroindol-1-yl)ethanone.
Molecular Properties
| Compound Name | 2-amino-1-(2,3-dihydroindol-1-yl)ethanone |
| PubChem CID | 22034314 |
| Molecular Formula | C10H12N2O |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | 2-amino-1-(2,3-dihydroindol-1-yl)ethanone |
| SMILES | NCC(=O)N1CCc2ccccc21 |
| InChI | InChI=1S/C10H12N2O/c11-7-10(13)12-6-5-8-3-1-2-4-9(8)12/h1-4H,5-7,11H2 |
| InChIKey | WLXBBTRDAKJZQM-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-amino-1-(2,3-dihydroindol-1-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-1-(2,3-dihydroindol-1-yl)ethanone?
The IUPAC name of 2-amino-1-(2,3-dihydroindol-1-yl)ethanone (CID 22034314) is 2-amino-1-(2,3-dihydroindol-1-yl)ethanone.
What is the SMILES notation for 2-amino-1-(2,3-dihydroindol-1-yl)ethanone?
The canonical SMILES for 2-amino-1-(2,3-dihydroindol-1-yl)ethanone is NCC(=O)N1CCc2ccccc21.
What is the InChIKey of 2-amino-1-(2,3-dihydroindol-1-yl)ethanone?
The InChIKey is WLXBBTRDAKJZQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O/c11-7-10(13)12-6-5-8-3-1-2-4-9(8)12/h1-4H,5-7,11H2.
What are the key properties of 2-amino-1-(2,3-dihydroindol-1-yl)ethanone?
2-amino-1-(2,3-dihydroindol-1-yl)ethanone has a molecular weight of 176.22 g/mol, XLogP of 0.53, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-1-(2,3-dihydroindol-1-yl)ethanone is sourced from PubChem (CID 22034314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).