About 2-sulfonylindole
2-sulfonylindole (PubChem CID 22034373) has the molecular formula C8H5NO2S
and a molecular weight of 179.20 g/mol. Its IUPAC name is 2-sulfonylindole.
Molecular Properties
| Compound Name | 2-sulfonylindole |
| PubChem CID | 22034373 |
| Molecular Formula | C8H5NO2S |
| Molecular Weight | 179.20 g/mol |
| Exact Mass | 179.00 |
| IUPAC Name | 2-sulfonylindole |
| SMILES | O=S(=O)=C1C=c2ccccc2=N1 |
| InChI | InChI=1S/C8H5NO2S/c10-12(11)8-5-6-3-1-2-4-7(6)9-8/h1-5H |
| InChIKey | DWLZJKNCWVJFOO-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.20 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-sulfonylindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-sulfonylindole?
The IUPAC name of 2-sulfonylindole (CID 22034373) is 2-sulfonylindole.
What is the SMILES notation for 2-sulfonylindole?
The canonical SMILES for 2-sulfonylindole is O=S(=O)=C1C=c2ccccc2=N1.
What is the InChIKey of 2-sulfonylindole?
The InChIKey is DWLZJKNCWVJFOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5NO2S/c10-12(11)8-5-6-3-1-2-4-7(6)9-8/h1-5H.
What are the key properties of 2-sulfonylindole?
2-sulfonylindole has a molecular weight of 179.20 g/mol, XLogP of -0.89, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-sulfonylindole is sourced from PubChem (CID 22034373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).