About bis(2-methylprop-2-enoic acid);phenol
bis(2-methylprop-2-enoic acid);phenol (PubChem CID 22034397) has the molecular formula C14H18O5
and a molecular weight of 266.29 g/mol. Its IUPAC name is bis(2-methylprop-2-enoic acid);phenol.
Molecular Properties
| Compound Name | bis(2-methylprop-2-enoic acid);phenol |
| PubChem CID | 22034397 |
| Molecular Formula | C14H18O5 |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | bis(2-methylprop-2-enoic acid);phenol |
| SMILES | C=C(C)C(=O)O.C=C(C)C(=O)O.Oc1ccccc1 |
| InChI | InChI=1S/C6H6O.2C4H6O2/c7-6-4-2-1-3-5-6;2*1-3(2)4(5)6/h1-5,7H;2*1H2,2H3,(H,5,6) |
| InChIKey | SKESERDUDQOXKM-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze bis(2-methylprop-2-enoic acid);phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-methylprop-2-enoic acid);phenol?
The IUPAC name of bis(2-methylprop-2-enoic acid);phenol (CID 22034397) is bis(2-methylprop-2-enoic acid);phenol.
What is the SMILES notation for bis(2-methylprop-2-enoic acid);phenol?
The canonical SMILES for bis(2-methylprop-2-enoic acid);phenol is C=C(C)C(=O)O.C=C(C)C(=O)O.Oc1ccccc1.
What is the InChIKey of bis(2-methylprop-2-enoic acid);phenol?
The InChIKey is SKESERDUDQOXKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6O.2C4H6O2/c7-6-4-2-1-3-5-6;2*1-3(2)4(5)6/h1-5,7H;2*1H2,2H3,(H,5,6).
What are the key properties of bis(2-methylprop-2-enoic acid);phenol?
bis(2-methylprop-2-enoic acid);phenol has a molecular weight of 266.29 g/mol, XLogP of 2.69, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-methylprop-2-enoic acid);phenol is sourced from PubChem (CID 22034397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).